C9H7ClN6 — CID 62502767
2-chloro-6-(2H-tetrazol-5-ylmethylamino)benzonitrile (PubChem CID 62502767) has the molecular formula C9H7ClN6 and a molecular weight of 234.65 g/mol. Its IUPAC name is 2-chloro-6-(2H-tetrazol-5-ylmethylamino)benzonitrile.
| Compound Name | 2-chloro-6-(2H-tetrazol-5-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 62502767 |
| Molecular Formula | C9H7ClN6 |
| Molecular Weight | 234.65 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 2-chloro-6-(2H-tetrazol-5-ylmethylamino)benzonitrile |
| SMILES | N#Cc1c(Cl)cccc1NCc1nn[nH]n1 |
| InChI | InChI=1S/C9H7ClN6/c10-7-2-1-3-8(6(7)4-11)12-5-9-13-15-16-14-9/h1-3,12H,5H2,(H,13,14,15,16) |
| InChIKey | DOKCUXUNUZPRHN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.65 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |