C11H12N6S — CID 113385947
2-ethylsulfanyl-6-(2H-tetrazol-5-ylmethylamino)benzonitrile (PubChem CID 113385947) has the molecular formula C11H12N6S and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-(2H-tetrazol-5-ylmethylamino)benzonitrile.
| Compound Name | 2-ethylsulfanyl-6-(2H-tetrazol-5-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 113385947 |
| Molecular Formula | C11H12N6S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-ethylsulfanyl-6-(2H-tetrazol-5-ylmethylamino)benzonitrile |
| SMILES | CCSc1cccc(NCc2nn[nH]n2)c1C#N |
| InChI | InChI=1S/C11H12N6S/c1-2-18-10-5-3-4-9(8(10)6-12)13-7-11-14-16-17-15-11/h3-5,13H,2,7H2,1H3,(H,14,15,16,17) |
| InChIKey | TZNQHYRREQPERG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |