C14H18N2S2 — CID 107296228
2-ethylsulfanyl-6-(thiolan-3-ylmethylamino)benzonitrile (PubChem CID 107296228) has the molecular formula C14H18N2S2 and a molecular weight of 278.45 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-(thiolan-3-ylmethylamino)benzonitrile.
| Compound Name | 2-ethylsulfanyl-6-(thiolan-3-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 107296228 |
| Molecular Formula | C14H18N2S2 |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-ethylsulfanyl-6-(thiolan-3-ylmethylamino)benzonitrile |
| SMILES | CCSc1cccc(NCC2CCSC2)c1C#N |
| InChI | InChI=1S/C14H18N2S2/c1-2-18-14-5-3-4-13(12(14)8-15)16-9-11-6-7-17-10-11/h3-5,11,16H,2,6-7,9-10H2,1H3 |
| InChIKey | YSKRHLKXQPVDTL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |