C17H24N2S — CID 106011541
2-(3-cyclopentylpropylamino)-6-ethylsulfanylbenzonitrile (PubChem CID 106011541) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is 2-(3-cyclopentylpropylamino)-6-ethylsulfanylbenzonitrile.
| Compound Name | 2-(3-cyclopentylpropylamino)-6-ethylsulfanylbenzonitrile |
|---|---|
| PubChem CID | 106011541 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-(3-cyclopentylpropylamino)-6-ethylsulfanylbenzonitrile |
| SMILES | CCSc1cccc(NCCCC2CCCC2)c1C#N |
| InChI | InChI=1S/C17H24N2S/c1-2-20-17-11-5-10-16(15(17)13-18)19-12-6-9-14-7-3-4-8-14/h5,10-11,14,19H,2-4,6-9,12H2,1H3 |
| InChIKey | UQEQWAFBBBYFHR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|