C19H22N2 — CID 106011557
4-(3-cyclopentylpropylamino)naphthalene-1-carbonitrile (PubChem CID 106011557) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-(3-cyclopentylpropylamino)naphthalene-1-carbonitrile.
| Compound Name | 4-(3-cyclopentylpropylamino)naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 106011557 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 4-(3-cyclopentylpropylamino)naphthalene-1-carbonitrile |
| SMILES | N#Cc1ccc(NCCCC2CCCC2)c2ccccc12 |
| InChI | InChI=1S/C19H22N2/c20-14-16-11-12-19(18-10-4-3-9-17(16)18)21-13-5-8-15-6-1-2-7-15/h3-4,9-12,15,21H,1-2,5-8,13H2 |
| InChIKey | OSGZDLXLDMWVIH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|