C18H21N3 — CID 106011499
2-(3-cyclopentylpropylamino)quinoline-4-carbonitrile (PubChem CID 106011499) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is 2-(3-cyclopentylpropylamino)quinoline-4-carbonitrile.
| Compound Name | 2-(3-cyclopentylpropylamino)quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 106011499 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-(3-cyclopentylpropylamino)quinoline-4-carbonitrile |
| SMILES | N#Cc1cc(NCCCC2CCCC2)nc2ccccc12 |
| InChI | InChI=1S/C18H21N3/c19-13-15-12-18(21-17-10-4-3-9-16(15)17)20-11-5-8-14-6-1-2-7-14/h3-4,9-10,12,14H,1-2,5-8,11H2,(H,20,21) |
| InChIKey | HWWSUIPGXNLSIB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|