C14H15N3OS — CID 115637217
2-(3-methylsulfinylpropylamino)quinoline-4-carbonitrile (PubChem CID 115637217) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-(3-methylsulfinylpropylamino)quinoline-4-carbonitrile.
| Compound Name | 2-(3-methylsulfinylpropylamino)quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 115637217 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-(3-methylsulfinylpropylamino)quinoline-4-carbonitrile |
| SMILES | CS(=O)CCCNc1cc(C#N)c2ccccc2n1 |
| InChI | InChI=1S/C14H15N3OS/c1-19(18)8-4-7-16-14-9-11(10-15)12-5-2-3-6-13(12)17-14/h2-3,5-6,9H,4,7-8H2,1H3,(H,16,17) |
| InChIKey | SVKYIIXIWQJGNZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|