C13H10F3N3S — CID 102809256
2-[2-(trifluoromethylsulfanyl)ethylamino]quinoline-4-carbonitrile (PubChem CID 102809256) has the molecular formula C13H10F3N3S and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[2-(trifluoromethylsulfanyl)ethylamino]quinoline-4-carbonitrile.
| Compound Name | 2-[2-(trifluoromethylsulfanyl)ethylamino]quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 102809256 |
| Molecular Formula | C13H10F3N3S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-[2-(trifluoromethylsulfanyl)ethylamino]quinoline-4-carbonitrile |
| SMILES | N#Cc1cc(NCCSC(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C13H10F3N3S/c14-13(15,16)20-6-5-18-12-7-9(8-17)10-3-1-2-4-11(10)19-12/h1-4,7H,5-6H2,(H,18,19) |
| InChIKey | SKOWNYWFWUCPRI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|