C15H18N4S — CID 106105144
2-ethylsulfanyl-6-[2-(1-methylpyrazol-3-yl)ethylamino]benzonitrile (PubChem CID 106105144) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-[2-(1-methylpyrazol-3-yl)ethylamino]benzonitrile.
| Compound Name | 2-ethylsulfanyl-6-[2-(1-methylpyrazol-3-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 106105144 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-ethylsulfanyl-6-[2-(1-methylpyrazol-3-yl)ethylamino]benzonitrile |
| SMILES | CCSc1cccc(NCCc2ccn(C)n2)c1C#N |
| InChI | InChI=1S/C15H18N4S/c1-3-20-15-6-4-5-14(13(15)11-16)17-9-7-12-8-10-19(2)18-12/h4-6,8,10,17H,3,7,9H2,1-2H3 |
| InChIKey | GPUJMOFSQJIRDP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |