C13H13FN4 — CID 104626482
2-fluoro-6-[2-(1-methylpyrazol-3-yl)ethylamino]benzonitrile (PubChem CID 104626482) has the molecular formula C13H13FN4 and a molecular weight of 244.27 g/mol. Its IUPAC name is 2-fluoro-6-[2-(1-methylpyrazol-3-yl)ethylamino]benzonitrile.
| Compound Name | 2-fluoro-6-[2-(1-methylpyrazol-3-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 104626482 |
| Molecular Formula | C13H13FN4 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-fluoro-6-[2-(1-methylpyrazol-3-yl)ethylamino]benzonitrile |
| SMILES | Cn1ccc(CCNc2cccc(F)c2C#N)n1 |
| InChI | InChI=1S/C13H13FN4/c1-18-8-6-10(17-18)5-7-16-13-4-2-3-12(14)11(13)9-15/h2-4,6,8,16H,5,7H2,1H3 |
| InChIKey | ROKOWGYYZKWDNB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |