C12H13N5 — CID 104626517
5-[2-(1-methylpyrazol-3-yl)ethylamino]pyridine-2-carbonitrile (PubChem CID 104626517) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 5-[2-(1-methylpyrazol-3-yl)ethylamino]pyridine-2-carbonitrile.
| Compound Name | 5-[2-(1-methylpyrazol-3-yl)ethylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 104626517 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 5-[2-(1-methylpyrazol-3-yl)ethylamino]pyridine-2-carbonitrile |
| SMILES | Cn1ccc(CCNc2ccc(C#N)nc2)n1 |
| InChI | InChI=1S/C12H13N5/c1-17-7-5-10(16-17)4-6-14-12-3-2-11(8-13)15-9-12/h2-3,5,7,9,14H,4,6H2,1H3 |
| InChIKey | YUQCQLKCMRPCJW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |