C13H13BrN4 — CID 106105146
4-bromo-2-[2-(1-methylpyrazol-3-yl)ethylamino]benzonitrile (PubChem CID 106105146) has the molecular formula C13H13BrN4 and a molecular weight of 305.18 g/mol. Its IUPAC name is 4-bromo-2-[2-(1-methylpyrazol-3-yl)ethylamino]benzonitrile.
| Compound Name | 4-bromo-2-[2-(1-methylpyrazol-3-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 106105146 |
| Molecular Formula | C13H13BrN4 |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 4-bromo-2-[2-(1-methylpyrazol-3-yl)ethylamino]benzonitrile |
| SMILES | Cn1ccc(CCNc2cc(Br)ccc2C#N)n1 |
| InChI | InChI=1S/C13H13BrN4/c1-18-7-5-12(17-18)4-6-16-13-8-11(14)3-2-10(13)9-15/h2-3,5,7-8,16H,4,6H2,1H3 |
| InChIKey | YIHVUTFRVSSILB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |