C14H20N2OS2 — CID 106246025
2-ethylsulfanyl-6-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]benzonitrile (PubChem CID 106246025) has the molecular formula C14H20N2OS2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]benzonitrile.
| Compound Name | 2-ethylsulfanyl-6-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]benzonitrile |
|---|---|
| PubChem CID | 106246025 |
| Molecular Formula | C14H20N2OS2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-ethylsulfanyl-6-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]benzonitrile |
| SMILES | CCSc1cccc(NCC(C)(O)CSC)c1C#N |
| InChI | InChI=1S/C14H20N2OS2/c1-4-19-13-7-5-6-12(11(13)8-15)16-9-14(2,17)10-18-3/h5-7,16-17H,4,9-10H2,1-3H3 |
| InChIKey | HJDUDNKWGFZGPB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |