C13H18N2S3 — CID 107296337
2-methylsulfanyl-6-(thiolan-3-ylmethylamino)benzenecarbothioamide (PubChem CID 107296337) has the molecular formula C13H18N2S3 and a molecular weight of 298.50 g/mol. Its IUPAC name is 2-methylsulfanyl-6-(thiolan-3-ylmethylamino)benzenecarbothioamide.
| Compound Name | 2-methylsulfanyl-6-(thiolan-3-ylmethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107296337 |
| Molecular Formula | C13H18N2S3 |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-methylsulfanyl-6-(thiolan-3-ylmethylamino)benzenecarbothioamide |
| SMILES | CSc1cccc(NCC2CCSC2)c1C(N)=S |
| InChI | InChI=1S/C13H18N2S3/c1-17-11-4-2-3-10(12(11)13(14)16)15-7-9-5-6-18-8-9/h2-4,9,15H,5-8H2,1H3,(H2,14,16) |
| InChIKey | MPWZWVBRPLCCQJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|