C13H21N3S2 — CID 113385733
2-[2-(dimethylamino)propylamino]-6-methylsulfanylbenzenecarbothioamide (PubChem CID 113385733) has the molecular formula C13H21N3S2 and a molecular weight of 283.47 g/mol. Its IUPAC name is 2-[2-(dimethylamino)propylamino]-6-methylsulfanylbenzenecarbothioamide.
| Compound Name | 2-[2-(dimethylamino)propylamino]-6-methylsulfanylbenzenecarbothioamide |
|---|---|
| PubChem CID | 113385733 |
| Molecular Formula | C13H21N3S2 |
| Molecular Weight | 283.47 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-[2-(dimethylamino)propylamino]-6-methylsulfanylbenzenecarbothioamide |
| SMILES | CSc1cccc(NCC(C)N(C)C)c1C(N)=S |
| InChI | InChI=1S/C13H21N3S2/c1-9(16(2)3)8-15-10-6-5-7-11(18-4)12(10)13(14)17/h5-7,9,15H,8H2,1-4H3,(H2,14,17) |
| InChIKey | HYURNYZRTHQCEX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|