About 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide
2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide (PubChem CID 113385759) has the molecular formula C12H13N3OS2
and a molecular weight of 279.39 g/mol. Its IUPAC name is 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide.
Molecular Properties
| Compound Name | 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide |
| PubChem CID | 113385759 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide |
| SMILES | CSc1cccc(NCc2ccon2)c1C(N)=S |
| InChI | InChI=1S/C12H13N3OS2/c1-18-10-4-2-3-9(11(10)12(13)17)14-7-8-5-6-16-15-8/h2-6,14H,7H2,1H3,(H2,13,17) |
| InChIKey | COZZEYOCXRREEY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide?
The IUPAC name of 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide (CID 113385759) is 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide.
What is the SMILES notation for 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide?
The canonical SMILES for 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide is CSc1cccc(NCc2ccon2)c1C(N)=S.
What is the InChIKey of 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide?
The InChIKey is COZZEYOCXRREEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3OS2/c1-18-10-4-2-3-9(11(10)12(13)17)14-7-8-5-6-16-15-8/h2-6,14H,7H2,1H3,(H2,13,17).
What are the key properties of 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide?
2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide has a molecular weight of 279.39 g/mol, XLogP of 2.64, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-6-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide is sourced from PubChem (CID 113385759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).