C11H10FN3OS — CID 115368501
2-fluoro-4-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide (PubChem CID 115368501) has the molecular formula C11H10FN3OS and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-fluoro-4-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide.
| Compound Name | 2-fluoro-4-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 115368501 |
| Molecular Formula | C11H10FN3OS |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-fluoro-4-(1,2-oxazol-3-ylmethylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCc2ccon2)cc1F |
| InChI | InChI=1S/C11H10FN3OS/c12-10-5-7(1-2-9(10)11(13)17)14-6-8-3-4-16-15-8/h1-5,14H,6H2,(H2,13,17) |
| InChIKey | KMXPWWIJFVPODY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|