C12H12FN3OS — CID 113295875
2-fluoro-4-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzenecarbothioamide (PubChem CID 113295875) has the molecular formula C12H12FN3OS and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-fluoro-4-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzenecarbothioamide.
| Compound Name | 2-fluoro-4-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 113295875 |
| Molecular Formula | C12H12FN3OS |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-fluoro-4-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzenecarbothioamide |
| SMILES | Cc1cc(CNc2ccc(C(N)=S)c(F)c2)on1 |
| InChI | InChI=1S/C12H12FN3OS/c1-7-4-9(17-16-7)6-15-8-2-3-10(12(14)18)11(13)5-8/h2-5,15H,6H2,1H3,(H2,14,18) |
| InChIKey | UCIPGPSVFOASAZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|