C12H12N4O — CID 113323939
2-amino-5-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile (PubChem CID 113323939) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-amino-5-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile.
| Compound Name | 2-amino-5-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 113323939 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-amino-5-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile |
| SMILES | Cc1cc(CNc2ccc(N)c(C#N)c2)on1 |
| InChI | InChI=1S/C12H12N4O/c1-8-4-11(17-16-8)7-15-10-2-3-12(14)9(5-10)6-13/h2-5,15H,7,14H2,1H3 |
| InChIKey | XEHKERMPMNKZIC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|