About 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile
5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile (PubChem CID 79839784) has the molecular formula C11H10N4O
and a molecular weight of 214.23 g/mol. Its IUPAC name is 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile |
| PubChem CID | 79839784 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile |
| SMILES | Cc1cc(CNc2ccc(C#N)nc2)on1 |
| InChI | InChI=1S/C11H10N4O/c1-8-4-11(16-15-8)7-14-10-3-2-9(5-12)13-6-10/h2-4,6,14H,7H2,1H3 |
| InChIKey | KTSQKFBEGHBSIO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile?
The IUPAC name of 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile (CID 79839784) is 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile.
What is the SMILES notation for 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile?
The canonical SMILES for 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile is Cc1cc(CNc2ccc(C#N)nc2)on1.
What is the InChIKey of 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile?
The InChIKey is KTSQKFBEGHBSIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O/c1-8-4-11(16-15-8)7-14-10-3-2-9(5-12)13-6-10/h2-4,6,14H,7H2,1H3.
What are the key properties of 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile?
5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile has a molecular weight of 214.23 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-methyl-1,2-oxazol-5-yl)methylamino]pyridine-2-carbonitrile is sourced from PubChem (CID 79839784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).