C10H10ClN3O — CID 103756549
2-chloro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]pyridin-4-amine (PubChem CID 103756549) has the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. Its IUPAC name is 2-chloro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 103756549 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-chloro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]pyridin-4-amine |
| SMILES | Cc1cc(CNc2ccnc(Cl)c2)on1 |
| InChI | InChI=1S/C10H10ClN3O/c1-7-4-9(15-14-7)6-13-8-2-3-12-10(11)5-8/h2-5H,6H2,1H3,(H,12,13) |
| InChIKey | JXFIWQAINQUBJN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|