C6H10N2O2 — CID 82594380
N-methoxy-1-(3-methyl-1,2-oxazol-5-yl)methanamine (PubChem CID 82594380) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is N-methoxy-1-(3-methyl-1,2-oxazol-5-yl)methanamine.
| Compound Name | N-methoxy-1-(3-methyl-1,2-oxazol-5-yl)methanamine |
|---|---|
| PubChem CID | 82594380 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | N-methoxy-1-(3-methyl-1,2-oxazol-5-yl)methanamine |
| SMILES | CONCc1cc(C)no1 |
| InChI | InChI=1S/C6H10N2O2/c1-5-3-6(10-8-5)4-7-9-2/h3,7H,4H2,1-2H3 |
| InChIKey | CPZYTVRXYBUQEU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|