C7H11N3O2 — CID 53017221
1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]urea (PubChem CID 53017221) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]urea.
| Compound Name | 1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 53017221 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 1-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]urea |
| SMILES | CNC(=O)NCc1cc(C)no1 |
| InChI | InChI=1S/C7H11N3O2/c1-5-3-6(12-10-5)4-9-7(11)8-2/h3H,4H2,1-2H3,(H2,8,9,11) |
| InChIKey | UGKQABQSTHRKBE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |