C8H14N4O — CID 130969421
1,2-dimethyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 130969421) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 130969421 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1,2-dimethyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | C/N=C(\NC)NCc1cc(C)no1 |
| InChI | InChI=1S/C8H14N4O/c1-6-4-7(13-12-6)5-11-8(9-2)10-3/h4H,5H2,1-3H3,(H2,9,10,11) |
| InChIKey | BLRQEFUWXLJXPO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|