C9H17N5 — CID 131114979
1-[(2,5-dimethylpyrazol-3-yl)methyl]-2,3-dimethylguanidine (PubChem CID 131114979) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 1-[(2,5-dimethylpyrazol-3-yl)methyl]-2,3-dimethylguanidine.
| Compound Name | 1-[(2,5-dimethylpyrazol-3-yl)methyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 131114979 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 1-[(2,5-dimethylpyrazol-3-yl)methyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCc1cc(C)nn1C |
| InChI | InChI=1S/C9H17N5/c1-7-5-8(14(4)13-7)6-12-9(10-2)11-3/h5H,6H2,1-4H3,(H2,10,11,12) |
| InChIKey | HQXFSJCBDOJTSK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|