C8H13N3O2 — CID 53017228
1-ethyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]urea (PubChem CID 53017228) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 1-ethyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]urea.
| Compound Name | 1-ethyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 53017228 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 1-ethyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]urea |
| SMILES | CCNC(=O)NCc1cc(C)no1 |
| InChI | InChI=1S/C8H13N3O2/c1-3-9-8(12)10-5-7-4-6(2)11-13-7/h4H,3,5H2,1-2H3,(H2,9,10,12) |
| InChIKey | HAAIQPHAWJWLKF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |