C14H21IN4O3 — CID 119141589
1-[2-hydroxy-2-(5-methylfuran-2-yl)ethyl]-2-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 119141589) has the molecular formula C14H21IN4O3 and a molecular weight of 420.25 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(5-methylfuran-2-yl)ethyl]-2-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-hydroxy-2-(5-methylfuran-2-yl)ethyl]-2-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119141589 |
| Molecular Formula | C14H21IN4O3 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 1-[2-hydroxy-2-(5-methylfuran-2-yl)ethyl]-2-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(C)no1)NCC(O)c1ccc(C)o1.I |
| InChI | InChI=1S/C14H20N4O3.HI/c1-9-6-11(21-18-9)7-16-14(15-3)17-8-12(19)13-5-4-10(2)20-13;/h4-6,12,19H,7-8H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | PDWISIYNQINZGY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|