C12H14FN3O2 — CID 107259085
2-fluoro-5-methoxy-1-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzene-1,4-diamine (PubChem CID 107259085) has the molecular formula C12H14FN3O2 and a molecular weight of 251.26 g/mol. Its IUPAC name is 2-fluoro-5-methoxy-1-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzene-1,4-diamine.
| Compound Name | 2-fluoro-5-methoxy-1-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 107259085 |
| Molecular Formula | C12H14FN3O2 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-fluoro-5-methoxy-1-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzene-1,4-diamine |
| SMILES | COc1cc(NCc2cc(C)no2)c(F)cc1N |
| InChI | InChI=1S/C12H14FN3O2/c1-7-3-8(18-16-7)6-15-11-5-12(17-2)10(14)4-9(11)13/h3-5,15H,6,14H2,1-2H3 |
| InChIKey | XSNAUXBLWXDOOU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|