C11H12FN3O — CID 62376804
4-fluoro-2-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzene-1,2-diamine (PubChem CID 62376804) has the molecular formula C11H12FN3O and a molecular weight of 221.24 g/mol. Its IUPAC name is 4-fluoro-2-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-fluoro-2-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 62376804 |
| Molecular Formula | C11H12FN3O |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-fluoro-2-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzene-1,2-diamine |
| SMILES | Cc1cc(CNc2cc(F)ccc2N)on1 |
| InChI | InChI=1S/C11H12FN3O/c1-7-4-9(16-15-7)6-14-11-5-8(12)2-3-10(11)13/h2-5,14H,6,13H2,1H3 |
| InChIKey | FDKOSHQYYNSHHS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|