C11H12BrN3O — CID 65342229
4-bromo-2-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzene-1,2-diamine (PubChem CID 65342229) has the molecular formula C11H12BrN3O and a molecular weight of 282.14 g/mol. Its IUPAC name is 4-bromo-2-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 65342229 |
| Molecular Formula | C11H12BrN3O |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 4-bromo-2-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzene-1,2-diamine |
| SMILES | Cc1cc(CNc2cc(Br)ccc2N)on1 |
| InChI | InChI=1S/C11H12BrN3O/c1-7-4-9(16-15-7)6-14-11-5-8(12)2-3-10(11)13/h2-5,14H,6,13H2,1H3 |
| InChIKey | JEEKPRKNJODLBY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|