About 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile
2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile (PubChem CID 114880886) has the molecular formula C12H10BrN3O
and a molecular weight of 292.14 g/mol. Its IUPAC name is 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile.
Molecular Properties
| Compound Name | 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile |
| PubChem CID | 114880886 |
| Molecular Formula | C12H10BrN3O |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile |
| SMILES | Cc1cc(CNc2cccc(Br)c2C#N)on1 |
| InChI | InChI=1S/C12H10BrN3O/c1-8-5-9(17-16-8)7-15-12-4-2-3-11(13)10(12)6-14/h2-5,15H,7H2,1H3 |
| InChIKey | NFBLNTNZBSBHOW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile?
The IUPAC name of 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile (CID 114880886) is 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile.
What is the SMILES notation for 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile?
The canonical SMILES for 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile is Cc1cc(CNc2cccc(Br)c2C#N)on1.
What is the InChIKey of 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile?
The InChIKey is NFBLNTNZBSBHOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrN3O/c1-8-5-9(17-16-8)7-15-12-4-2-3-11(13)10(12)6-14/h2-5,15H,7H2,1H3.
What are the key properties of 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile?
2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile has a molecular weight of 292.14 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-[(3-methyl-1,2-oxazol-5-yl)methylamino]benzonitrile is sourced from PubChem (CID 114880886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).