C11H11FN2O — CID 126782089
3-fluoro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]aniline (PubChem CID 126782089) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is 3-fluoro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]aniline.
| Compound Name | 3-fluoro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 126782089 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3-fluoro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]aniline |
| SMILES | Cc1cc(CNc2cccc(F)c2)on1 |
| InChI | InChI=1S/C11H11FN2O/c1-8-5-11(15-14-8)7-13-10-4-2-3-9(12)6-10/h2-6,13H,7H2,1H3 |
| InChIKey | QPSCPWKJHKTZSH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |