C11H21N3O — CID 60719969
N',N'-diethyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine (PubChem CID 60719969) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is N',N'-diethyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 60719969 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N',N'-diethyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1cc(C)no1 |
| InChI | InChI=1S/C11H21N3O/c1-4-14(5-2)7-6-12-9-11-8-10(3)13-15-11/h8,12H,4-7,9H2,1-3H3 |
| InChIKey | PWLPFBPGWAQIRX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|