C12H12N4S — CID 113323976
2-amino-5-[(4-methyl-1,3-thiazol-5-yl)methylamino]benzonitrile (PubChem CID 113323976) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-amino-5-[(4-methyl-1,3-thiazol-5-yl)methylamino]benzonitrile.
| Compound Name | 2-amino-5-[(4-methyl-1,3-thiazol-5-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 113323976 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-amino-5-[(4-methyl-1,3-thiazol-5-yl)methylamino]benzonitrile |
| SMILES | Cc1ncsc1CNc1ccc(N)c(C#N)c1 |
| InChI | InChI=1S/C12H12N4S/c1-8-12(17-7-16-8)6-15-10-2-3-11(14)9(4-10)5-13/h2-4,7,15H,6,14H2,1H3 |
| InChIKey | YPMLWKBBIHOMMZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|