C10H9ClN4OS — CID 106399671
2-chloro-6-(1,2,4-oxadiazol-3-ylmethylamino)benzenecarbothioamide (PubChem CID 106399671) has the molecular formula C10H9ClN4OS and a molecular weight of 268.73 g/mol. Its IUPAC name is 2-chloro-6-(1,2,4-oxadiazol-3-ylmethylamino)benzenecarbothioamide.
| Compound Name | 2-chloro-6-(1,2,4-oxadiazol-3-ylmethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 106399671 |
| Molecular Formula | C10H9ClN4OS |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 2-chloro-6-(1,2,4-oxadiazol-3-ylmethylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1c(Cl)cccc1NCc1ncon1 |
| InChI | InChI=1S/C10H9ClN4OS/c11-6-2-1-3-7(9(6)10(12)17)13-4-8-14-5-16-15-8/h1-3,5,13H,4H2,(H2,12,17) |
| InChIKey | CJBUKWLTKGQWNP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|