C10H8F3N3O — CID 114184358
N-(1,2,4-oxadiazol-3-ylmethyl)-2-(trifluoromethyl)aniline (PubChem CID 114184358) has the molecular formula C10H8F3N3O and a molecular weight of 243.19 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)-2-(trifluoromethyl)aniline.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 114184358 |
| Molecular Formula | C10H8F3N3O |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)-2-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccccc1NCc1ncon1 |
| InChI | InChI=1S/C10H8F3N3O/c11-10(12,13)7-3-1-2-4-8(7)14-5-9-15-6-17-16-9/h1-4,6,14H,5H2 |
| InChIKey | AHABYHSUFZNQEI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |