C9H9N5OS — CID 106399667
5-(1,2,4-oxadiazol-3-ylmethylamino)pyridine-2-carbothioamide (PubChem CID 106399667) has the molecular formula C9H9N5OS and a molecular weight of 235.27 g/mol. Its IUPAC name is 5-(1,2,4-oxadiazol-3-ylmethylamino)pyridine-2-carbothioamide.
| Compound Name | 5-(1,2,4-oxadiazol-3-ylmethylamino)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 106399667 |
| Molecular Formula | C9H9N5OS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 5-(1,2,4-oxadiazol-3-ylmethylamino)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ccc(NCc2ncon2)cn1 |
| InChI | InChI=1S/C9H9N5OS/c10-9(16)7-2-1-6(3-12-7)11-4-8-13-5-15-14-8/h1-3,5,11H,4H2,(H2,10,16) |
| InChIKey | FHGJQYCRLZJCGC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|