C10H12N4O — CID 106393331
2-methyl-4-N-(1,2,4-oxadiazol-3-ylmethyl)benzene-1,4-diamine (PubChem CID 106393331) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-methyl-4-N-(1,2,4-oxadiazol-3-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2-methyl-4-N-(1,2,4-oxadiazol-3-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106393331 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-methyl-4-N-(1,2,4-oxadiazol-3-ylmethyl)benzene-1,4-diamine |
| SMILES | Cc1cc(NCc2ncon2)ccc1N |
| InChI | InChI=1S/C10H12N4O/c1-7-4-8(2-3-9(7)11)12-5-10-13-6-15-14-10/h2-4,6,12H,5,11H2,1H3 |
| InChIKey | HETYNPJVSGPWNS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|