C11H14N4O — CID 106394127
4-methyl-1-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzene-1,3-diamine (PubChem CID 106394127) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-methyl-1-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzene-1,3-diamine.
| Compound Name | 4-methyl-1-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 106394127 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-methyl-1-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzene-1,3-diamine |
| SMILES | Cc1ccc(NCCc2ncon2)cc1N |
| InChI | InChI=1S/C11H14N4O/c1-8-2-3-9(6-10(8)12)13-5-4-11-14-7-16-15-11/h2-3,6-7,13H,4-5,12H2,1H3 |
| InChIKey | BNSKKAFCFHEYDT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|