C10H11IN4O — CID 106393935
4-iodo-1-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzene-1,2-diamine (PubChem CID 106393935) has the molecular formula C10H11IN4O and a molecular weight of 330.13 g/mol. Its IUPAC name is 4-iodo-1-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-iodo-1-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 106393935 |
| Molecular Formula | C10H11IN4O |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 4-iodo-1-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzene-1,2-diamine |
| SMILES | Nc1cc(I)ccc1NCCc1ncon1 |
| InChI | InChI=1S/C10H11IN4O/c11-7-1-2-9(8(12)5-7)13-4-3-10-14-6-16-15-10/h1-2,5-6,13H,3-4,12H2 |
| InChIKey | RGJUFLQJAJQTJQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|