C16H17IN2O2 — CID 66066056
1-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-4-iodobenzene-1,2-diamine (PubChem CID 66066056) has the molecular formula C16H17IN2O2 and a molecular weight of 396.23 g/mol. Its IUPAC name is 1-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-4-iodobenzene-1,2-diamine.
| Compound Name | 1-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-4-iodobenzene-1,2-diamine |
|---|---|
| PubChem CID | 66066056 |
| Molecular Formula | C16H17IN2O2 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 1-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-4-iodobenzene-1,2-diamine |
| SMILES | Nc1cc(I)ccc1NCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H17IN2O2/c17-12-2-3-14(13(18)10-12)19-6-5-11-1-4-15-16(9-11)21-8-7-20-15/h1-4,9-10,19H,5-8,18H2 |
| InChIKey | ZNUINKCVDWRJSD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|