C22H21IN2O3 — CID 137405211
4-iodo-1-N-[[2-(4-methoxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]methyl]benzene-1,2-diamine (PubChem CID 137405211) has the molecular formula C22H21IN2O3 and a molecular weight of 488.33 g/mol. Its IUPAC name is 4-iodo-1-N-[[2-(4-methoxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]methyl]benzene-1,2-diamine.
| Compound Name | 4-iodo-1-N-[[2-(4-methoxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 137405211 |
| Molecular Formula | C22H21IN2O3 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 4-iodo-1-N-[[2-(4-methoxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]methyl]benzene-1,2-diamine |
| SMILES | COc1ccc(C2COc3cc(CNc4ccc(I)cc4N)ccc3O2)cc1 |
| InChI | InChI=1S/C22H21IN2O3/c1-26-17-6-3-15(4-7-17)22-13-27-21-10-14(2-9-20(21)28-22)12-25-19-8-5-16(23)11-18(19)24/h2-11,22,25H,12-13,24H2,1H3 |
| InChIKey | PWYLIRMWHVDIGO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|