C22H19IN2O5 — CID 126484054
4-iodo-N-[[2-(4-methoxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]methyl]-2-nitroaniline (PubChem CID 126484054) has the molecular formula C22H19IN2O5 and a molecular weight of 518.31 g/mol. Its IUPAC name is 4-iodo-N-[[2-(4-methoxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]methyl]-2-nitroaniline.
| Compound Name | 4-iodo-N-[[2-(4-methoxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]methyl]-2-nitroaniline |
|---|---|
| PubChem CID | 126484054 |
| Molecular Formula | C22H19IN2O5 |
| Molecular Weight | 518.31 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | 4-iodo-N-[[2-(4-methoxyphenyl)-2,3-dihydro-1,4-benzodioxin-6-yl]methyl]-2-nitroaniline |
| SMILES | COc1ccc(C2COc3cc(CNc4ccc(I)cc4[N+](=O)[O-])ccc3O2)cc1 |
| InChI | InChI=1S/C22H19IN2O5/c1-28-17-6-3-15(4-7-17)22-13-29-21-10-14(2-9-20(21)30-22)12-24-18-8-5-16(23)11-19(18)25(26)27/h2-11,22,24H,12-13H2,1H3 |
| InChIKey | WOAGBDXMYMYQAW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.31 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|