C15H15N3O5 — CID 9281277
N-[2-(4-methoxyphenyl)ethyl]-2,4-dinitroaniline (PubChem CID 9281277) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-2,4-dinitroaniline.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 9281277 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2,4-dinitroaniline |
| SMILES | COc1ccc(CCNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H15N3O5/c1-23-13-5-2-11(3-6-13)8-9-16-14-7-4-12(17(19)20)10-15(14)18(21)22/h2-7,10,16H,8-9H2,1H3 |
| InChIKey | VHKPPXFYABVHOL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|