C21H21N3O5S — CID 3953859
4-[2-(4-methoxyphenyl)ethylamino]-3-nitro-N-phenylbenzenesulfonamide (PubChem CID 3953859) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenyl)ethylamino]-3-nitro-N-phenylbenzenesulfonamide.
| Compound Name | 4-[2-(4-methoxyphenyl)ethylamino]-3-nitro-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 3953859 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 4-[2-(4-methoxyphenyl)ethylamino]-3-nitro-N-phenylbenzenesulfonamide |
| SMILES | COc1ccc(CCNc2ccc(S(=O)(=O)Nc3ccccc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21N3O5S/c1-29-18-9-7-16(8-10-18)13-14-22-20-12-11-19(15-21(20)24(25)26)30(27,28)23-17-5-3-2-4-6-17/h2-12,15,22-23H,13-14H2,1H3 |
| InChIKey | PPWAZXVQVKTGDF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|