C16H17ClN2O2 — CID 104833960
3-chloro-1-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]benzene-1,2-diamine (PubChem CID 104833960) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 3-chloro-1-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 3-chloro-1-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 104833960 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-chloro-1-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]benzene-1,2-diamine |
| SMILES | Nc1c(Cl)cccc1NCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H17ClN2O2/c17-12-2-1-3-13(16(12)18)19-7-6-11-4-5-14-15(10-11)21-9-8-20-14/h1-5,10,19H,6-9,18H2 |
| InChIKey | RLVALJVHSXLDIC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|