C9H9FN4O — CID 106393220
4-fluoro-1-N-(1,2,4-oxadiazol-3-ylmethyl)benzene-1,2-diamine (PubChem CID 106393220) has the molecular formula C9H9FN4O and a molecular weight of 208.20 g/mol. Its IUPAC name is 4-fluoro-1-N-(1,2,4-oxadiazol-3-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-1-N-(1,2,4-oxadiazol-3-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106393220 |
| Molecular Formula | C9H9FN4O |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 4-fluoro-1-N-(1,2,4-oxadiazol-3-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(F)ccc1NCc1ncon1 |
| InChI | InChI=1S/C9H9FN4O/c10-6-1-2-8(7(11)3-6)12-4-9-13-5-15-14-9/h1-3,5,12H,4,11H2 |
| InChIKey | HUWLQKLHVVYZGQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|