C10H13N5O3S — CID 106393414
4-amino-N-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)benzenesulfonamide (PubChem CID 106393414) has the molecular formula C10H13N5O3S and a molecular weight of 283.31 g/mol. Its IUPAC name is 4-amino-N-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)benzenesulfonamide.
| Compound Name | 4-amino-N-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 106393414 |
| Molecular Formula | C10H13N5O3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-amino-N-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N)c(NCc2ncon2)c1 |
| InChI | InChI=1S/C10H13N5O3S/c1-12-19(16,17)7-2-3-8(11)9(4-7)13-5-10-14-6-18-15-10/h2-4,6,12-13H,5,11H2,1H3 |
| InChIKey | FMHPCWSJKJLPGH-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|