C10H18N4O4S2 — CID 82900018
4-amino-N-methyl-3-(3-sulfamoylpropylamino)benzenesulfonamide (PubChem CID 82900018) has the molecular formula C10H18N4O4S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-amino-N-methyl-3-(3-sulfamoylpropylamino)benzenesulfonamide.
| Compound Name | 4-amino-N-methyl-3-(3-sulfamoylpropylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 82900018 |
| Molecular Formula | C10H18N4O4S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-amino-N-methyl-3-(3-sulfamoylpropylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N)c(NCCCS(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H18N4O4S2/c1-13-20(17,18)8-3-4-9(11)10(7-8)14-5-2-6-19(12,15)16/h3-4,7,13-14H,2,5-6,11H2,1H3,(H2,12,15,16) |
| InChIKey | IUPNCMNMLBJXGB-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|