C13H18N4O2S2 — CID 82901841
4-amino-N-methyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzenesulfonamide (PubChem CID 82901841) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 4-amino-N-methyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzenesulfonamide.
| Compound Name | 4-amino-N-methyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 82901841 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-amino-N-methyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N)c(NCCc2nc(C)cs2)c1 |
| InChI | InChI=1S/C13H18N4O2S2/c1-9-8-20-13(17-9)5-6-16-12-7-10(3-4-11(12)14)21(18,19)15-2/h3-4,7-8,15-16H,5-6,14H2,1-2H3 |
| InChIKey | UWAKEIQEIMIMDJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|